C9H11NO7S — CID 159529273
methanesulfonic acid;3-methyl-4-nitrobenzoic acid (PubChem CID 159529273) has the molecular formula C9H11NO7S and a molecular weight of 277.25 g/mol. Its IUPAC name is methanesulfonic acid;3-methyl-4-nitrobenzoic acid.
| Compound Name | methanesulfonic acid;3-methyl-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 159529273 |
| Molecular Formula | C9H11NO7S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | methanesulfonic acid;3-methyl-4-nitrobenzoic acid |
| SMILES | CS(=O)(=O)O.Cc1cc(C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO4.CH4O3S/c1-5-4-6(8(10)11)2-3-7(5)9(12)13;1-5(2,3)4/h2-4H,1H3,(H,10,11);1H3,(H,2,3,4) |
| InChIKey | MCTZXZJNXDHVAS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|