C12H16N2O6S — CID 96542030
[(2S)-1-(methanesulfonamido)propan-2-yl] 3-methyl-4-nitrobenzoate (PubChem CID 96542030) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is [(2S)-1-(methanesulfonamido)propan-2-yl] 3-methyl-4-nitrobenzoate.
| Compound Name | [(2S)-1-(methanesulfonamido)propan-2-yl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 96542030 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [(2S)-1-(methanesulfonamido)propan-2-yl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)O[C@@H](C)CNS(C)(=O)=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O6S/c1-8-6-10(4-5-11(8)14(16)17)12(15)20-9(2)7-13-21(3,18)19/h4-6,9,13H,7H2,1-3H3/t9-/m0/s1 |
| InChIKey | HPNXKTJIPURXOY-VIFPVBQESA-N |
| XLogP | 1.00 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|