C17H12N2O6S — CID 3718556
3-hydroxy-4-[(4-nitrophenyl)methylideneamino]naphthalene-1-sulfonic acid (PubChem CID 3718556) has the molecular formula C17H12N2O6S and a molecular weight of 372.36 g/mol. Its IUPAC name is 3-hydroxy-4-[(4-nitrophenyl)methylideneamino]naphthalene-1-sulfonic acid.
| Compound Name | 3-hydroxy-4-[(4-nitrophenyl)methylideneamino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 3718556 |
| Molecular Formula | C17H12N2O6S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 3-hydroxy-4-[(4-nitrophenyl)methylideneamino]naphthalene-1-sulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(/C=N/c2c(O)cc(S(=O)(=O)O)c3ccccc23)cc1 |
| InChI | InChI=1S/C17H12N2O6S/c20-15-9-16(26(23,24)25)13-3-1-2-4-14(13)17(15)18-10-11-5-7-12(8-6-11)19(21)22/h1-10,20H,(H,23,24,25)/b18-10+ |
| InChIKey | WJVNDTDLIUVTPM-VCHYOVAHSA-N |
| XLogP | 3.45 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|