C20H13N3O10S2 — CID 136855555
3-hydroxy-4-[(5-hydroxy-1-sulfonaphthalen-2-yl)diazenyl]-7-nitronaphthalene-1-sulfonic acid (PubChem CID 136855555) has the molecular formula C20H13N3O10S2 and a molecular weight of 519.47 g/mol. Its IUPAC name is 3-hydroxy-4-[(5-hydroxy-1-sulfonaphthalen-2-yl)diazenyl]-7-nitronaphthalene-1-sulfonic acid.
| Compound Name | 3-hydroxy-4-[(5-hydroxy-1-sulfonaphthalen-2-yl)diazenyl]-7-nitronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136855555 |
| Molecular Formula | C20H13N3O10S2 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.00 |
| IUPAC Name | 3-hydroxy-4-[(5-hydroxy-1-sulfonaphthalen-2-yl)diazenyl]-7-nitronaphthalene-1-sulfonic acid |
| SMILES | O=[N+]([O-])c1ccc2c(/N=N/c3ccc4c(O)cccc4c3S(=O)(=O)O)c(O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C20H13N3O10S2/c24-16-3-1-2-13-11(16)6-7-15(20(13)35(31,32)33)21-22-19-12-5-4-10(23(26)27)8-14(12)18(9-17(19)25)34(28,29)30/h1-9,24-25H,(H,28,29,30)(H,31,32,33)/b22-21+ |
| InChIKey | JZNGMGPPXSLJHM-QURGRASLSA-N |
| XLogP | 4.22 |
| TPSA | 217.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|