C10H7IN2O6S — CID 142275400
3-hydroxy-4-(iodoamino)-7-nitronaphthalene-1-sulfonic acid (PubChem CID 142275400) has the molecular formula C10H7IN2O6S and a molecular weight of 410.15 g/mol. Its IUPAC name is 3-hydroxy-4-(iodoamino)-7-nitronaphthalene-1-sulfonic acid.
| Compound Name | 3-hydroxy-4-(iodoamino)-7-nitronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 142275400 |
| Molecular Formula | C10H7IN2O6S |
| Molecular Weight | 410.15 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | 3-hydroxy-4-(iodoamino)-7-nitronaphthalene-1-sulfonic acid |
| SMILES | O=[N+]([O-])c1ccc2c(NI)c(O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C10H7IN2O6S/c11-12-10-6-2-1-5(13(15)16)3-7(6)9(4-8(10)14)20(17,18)19/h1-4,12,14H,(H,17,18,19) |
| InChIKey | QWQWPYZSLMQRSK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|