C14H10N2Na2O10S2 — CID 131878573
CID 131878573 (PubChem CID 131878573) has the molecular formula C14H10N2Na2O10S2 and a molecular weight of 476.35 g/mol.
| Compound Name | CID 131878573 |
|---|---|
| PubChem CID | 131878573 |
| Molecular Formula | C14H10N2Na2O10S2 |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.96 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2ccc([N+](=O)[O-])cc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[Na].[Na] |
| InChI | InChI=1S/C14H10N2O10S2.2Na/c17-15(18)11-5-3-9(13(7-11)27(21,22)23)1-2-10-4-6-12(16(19)20)8-14(10)28(24,25)26;;/h1-8H,(H,21,22,23)(H,24,25,26);; |
| InChIKey | KZRBDXBXDANSRJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|