C14H10N2O10S2 — CID 10251961
2-nitro-5-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 10251961) has the molecular formula C14H10N2O10S2 and a molecular weight of 430.37 g/mol. Its IUPAC name is 2-nitro-5-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 2-nitro-5-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 10251961 |
| Molecular Formula | C14H10N2O10S2 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 2-nitro-5-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2ccc([N+](=O)[O-])c(S(=O)(=O)O)c2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H10N2O10S2/c17-15(18)11-5-4-10(13(8-11)27(21,22)23)3-1-9-2-6-12(16(19)20)14(7-9)28(24,25)26/h1-8H,(H,21,22,23)(H,24,25,26)/b3-1+ |
| InChIKey | MTDPYDCKSUKVQX-HNQUOIGGSA-N |
| XLogP | 2.17 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|