C37H27N7O8S2 — CID 118052044
2-[[4-[(4-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-5-[[4-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 118052044) has the molecular formula C37H27N7O8S2 and a molecular weight of 761.80 g/mol. Its IUPAC name is 2-[[4-[(4-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-5-[[4-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[4-[(4-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-5-[[4-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 118052044 |
| Molecular Formula | C37H27N7O8S2 |
| Molecular Weight | 761.80 g/mol |
| Exact Mass | 761.14 |
| IUPAC Name | 2-[[4-[(4-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-5-[[4-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc(/C=C/c5ccc([N+](=O)[O-])cc5S(=O)(=O)O)cc4)cc3S(=O)(=O)O)c3ccccc23)cc1 |
| InChI | InChI=1S/C37H27N7O8S2/c1-24-6-13-27(14-7-24)39-41-33-20-21-34(32-5-3-2-4-31(32)33)42-43-35-19-17-29(22-37(35)54(50,51)52)40-38-28-15-9-25(10-16-28)8-11-26-12-18-30(44(45)46)23-36(26)53(47,48)49/h2-23H,1H3,(H,47,48,49)(H,50,51,52)/b11-8+,40-38+,41-39+,43-42+ |
| InChIKey | AOBKIQSJSMSDSH-QTSLDEHNSA-N |
| XLogP | 10.97 |
| TPSA | 226.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.80 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|