C29H24N4O8S2 — CID 90178737
2-methyl-5-[[4-[[4-[(E)-2-(4-methyl-2-sulfophenyl)ethenyl]phenyl]diazenyl]-2-sulfophenyl]diazenyl]benzoic acid (PubChem CID 90178737) has the molecular formula C29H24N4O8S2 and a molecular weight of 620.67 g/mol. Its IUPAC name is 2-methyl-5-[[4-[[4-[(E)-2-(4-methyl-2-sulfophenyl)ethenyl]phenyl]diazenyl]-2-sulfophenyl]diazenyl]benzoic acid.
| Compound Name | 2-methyl-5-[[4-[[4-[(E)-2-(4-methyl-2-sulfophenyl)ethenyl]phenyl]diazenyl]-2-sulfophenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 90178737 |
| Molecular Formula | C29H24N4O8S2 |
| Molecular Weight | 620.67 g/mol |
| Exact Mass | 620.10 |
| IUPAC Name | 2-methyl-5-[[4-[[4-[(E)-2-(4-methyl-2-sulfophenyl)ethenyl]phenyl]diazenyl]-2-sulfophenyl]diazenyl]benzoic acid |
| SMILES | Cc1ccc(/C=C/c2ccc(/N=N/c3ccc(/N=N/c4ccc(C)c(C(=O)O)c4)c(S(=O)(=O)O)c3)cc2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C29H24N4O8S2/c1-18-3-8-21(27(15-18)42(36,37)38)9-5-20-6-11-22(12-7-20)30-31-24-13-14-26(28(17-24)43(39,40)41)33-32-23-10-4-19(2)25(16-23)29(34)35/h3-17H,1-2H3,(H,34,35)(H,36,37,38)(H,39,40,41)/b9-5+,31-30+,33-32+ |
| InChIKey | GDBNPSIMGSGRNJ-YRWPJJPFSA-N |
| XLogP | 7.50 |
| TPSA | 195.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.67 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|