C26H20N4NaO14S4+ — CID 135499455
sodium 5-[(2-hydroxy-5-sulfophenyl)diazenyl]-2-[(E)-2-[4-[(2-hydroxy-5-sulfophenyl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 135499455) has the molecular formula C26H20N4NaO14S4+ and a molecular weight of 763.72 g/mol. Its IUPAC name is sodium 5-[(2-hydroxy-5-sulfophenyl)diazenyl]-2-[(E)-2-[4-[(2-hydroxy-5-sulfophenyl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | sodium 5-[(2-hydroxy-5-sulfophenyl)diazenyl]-2-[(E)-2-[4-[(2-hydroxy-5-sulfophenyl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135499455 |
| Molecular Formula | C26H20N4NaO14S4+ |
| Molecular Weight | 763.72 g/mol |
| Exact Mass | 762.98 |
| IUPAC Name | sodium 5-[(2-hydroxy-5-sulfophenyl)diazenyl]-2-[(E)-2-[4-[(2-hydroxy-5-sulfophenyl)diazenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(O)c(/N=N/c2ccc(/C=C/c3ccc(/N=N/c4cc(S(=O)(=O)O)ccc4O)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)c1.[Na+] |
| InChI | InChI=1S/C26H20N4O14S4.Na/c31-23-9-7-19(45(33,34)35)13-21(23)29-27-17-5-3-15(25(11-17)47(39,40)41)1-2-16-4-6-18(12-26(16)48(42,43)44)28-30-22-14-20(46(36,37)38)8-10-24(22)32;/h1-14,31-32H,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,42,43,44);/q;+1/b2-1+,29-27+,30-28+; |
| InChIKey | NFEFCGIHQHNYBS-MDHXDFCHSA-N |
| XLogP | 2.09 |
| TPSA | 307.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.72 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|