C34H26N6O9S3 — CID 10010342
5-amino-8-[[4-[(E)-2-[4-[(4-amino-7-sulfonaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 10010342) has the molecular formula C34H26N6O9S3 and a molecular weight of 758.82 g/mol. Its IUPAC name is 5-amino-8-[[4-[(E)-2-[4-[(4-amino-7-sulfonaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-amino-8-[[4-[(E)-2-[4-[(4-amino-7-sulfonaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 10010342 |
| Molecular Formula | C34H26N6O9S3 |
| Molecular Weight | 758.82 g/mol |
| Exact Mass | 758.09 |
| IUPAC Name | 5-amino-8-[[4-[(E)-2-[4-[(4-amino-7-sulfonaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(/C=C/c3ccc(/N=N/c4ccc(N)c5ccc(S(=O)(=O)O)cc45)cc3S(=O)(=O)O)cc2)c2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C34H26N6O9S3/c35-30-13-15-32(28-18-24(50(41,42)43)9-11-26(28)30)39-37-22-6-2-20(3-7-22)1-4-21-5-8-23(17-34(21)52(47,48)49)38-40-33-16-14-31(36)27-12-10-25(19-29(27)33)51(44,45)46/h1-19H,35-36H2,(H,41,42,43)(H,44,45,46)(H,47,48,49)/b4-1+,39-37+,40-38+ |
| InChIKey | OELUMSGPXSUDAQ-CWQJHWJDSA-N |
| XLogP | 7.90 |
| TPSA | 264.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.82 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|