C34H26N6NaO12S4+ — CID 54599676
sodium 8-amino-5-[[4-[(E)-2-[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 54599676) has the molecular formula C34H26N6NaO12S4+ and a molecular weight of 861.87 g/mol. Its IUPAC name is sodium 8-amino-5-[[4-[(E)-2-[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | sodium 8-amino-5-[[4-[(E)-2-[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 54599676 |
| Molecular Formula | C34H26N6NaO12S4+ |
| Molecular Weight | 861.87 g/mol |
| Exact Mass | 861.04 |
| IUPAC Name | sodium 8-amino-5-[[4-[(E)-2-[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(/C=C/c3ccc(/N=N/c4ccc(N)c5cc(S(=O)(=O)O)ccc45)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)c2ccc(S(=O)(=O)O)cc12.[Na+] |
| InChI | InChI=1S/C34H26N6O12S4.Na/c35-29-11-13-31(25-9-7-23(17-27(25)29)53(41,42)43)39-37-21-5-3-19(33(15-21)55(47,48)49)1-2-20-4-6-22(16-34(20)56(50,51)52)38-40-32-14-12-30(36)28-18-24(54(44,45)46)8-10-26(28)32;/h1-18H,35-36H2,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,50,51,52);/q;+1/b2-1+,39-37+,40-38+; |
| InChIKey | HUAXKVLMQUQEKT-XFQDGJEGSA-N |
| XLogP | 4.15 |
| TPSA | 318.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|