C26H19N5O9S3 — CID 88888450
5-amino-8-[[7-sulfo-4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 88888450) has the molecular formula C26H19N5O9S3 and a molecular weight of 641.67 g/mol. Its IUPAC name is 5-amino-8-[[7-sulfo-4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 5-amino-8-[[7-sulfo-4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 88888450 |
| Molecular Formula | C26H19N5O9S3 |
| Molecular Weight | 641.67 g/mol |
| Exact Mass | 641.03 |
| IUPAC Name | 5-amino-8-[[7-sulfo-4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(/N=N/c3cccc(S(=O)(=O)O)c3)c3ccc(S(=O)(=O)O)cc23)c2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C26H19N5O9S3/c27-21-9-10-24(26-19(21)5-2-6-25(26)43(38,39)40)31-30-23-12-11-22(18-8-7-17(14-20(18)23)42(35,36)37)29-28-15-3-1-4-16(13-15)41(32,33)34/h1-14H,27H2,(H,32,33,34)(H,35,36,37)(H,38,39,40)/b29-28+,31-30+ |
| InChIKey | PMNSKUOMYICDJD-DUJDKOHPSA-N |
| XLogP | 6.15 |
| TPSA | 238.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.67 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|