C22H15N4NaO4S — CID 102267652
sodium 4-[[4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]phenolate (PubChem CID 102267652) has the molecular formula C22H15N4NaO4S and a molecular weight of 454.44 g/mol. Its IUPAC name is sodium 4-[[4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]phenolate.
| Compound Name | sodium 4-[[4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]phenolate |
|---|---|
| PubChem CID | 102267652 |
| Molecular Formula | C22H15N4NaO4S |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | sodium 4-[[4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]phenolate |
| SMILES | O=S(=O)(O)c1cccc(/N=N/c2ccc(/N=N/c3ccc([O-])cc3)c3ccccc23)c1.[Na+] |
| InChI | InChI=1S/C22H16N4O4S.Na/c27-17-10-8-15(9-11-17)23-25-21-12-13-22(20-7-2-1-6-19(20)21)26-24-16-4-3-5-18(14-16)31(28,29)30;/h1-14,27H,(H,28,29,30);/q;+1/p-1/b25-23+,26-24+; |
| InChIKey | JERQGCCANBFCPP-MVAKMUFYSA-M |
| XLogP | 2.99 |
| TPSA | 126.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|