C32H25N5O6S2 — CID 147459915
8-anilino-5-[2-[4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]hydrazinyl]naphthalene-1-sulfonic acid (PubChem CID 147459915) has the molecular formula C32H25N5O6S2 and a molecular weight of 639.72 g/mol. Its IUPAC name is 8-anilino-5-[2-[4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]hydrazinyl]naphthalene-1-sulfonic acid.
| Compound Name | 8-anilino-5-[2-[4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]hydrazinyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 147459915 |
| Molecular Formula | C32H25N5O6S2 |
| Molecular Weight | 639.72 g/mol |
| Exact Mass | 639.12 |
| IUPAC Name | 8-anilino-5-[2-[4-[(3-sulfophenyl)diazenyl]naphthalen-1-yl]hydrazinyl]naphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(/N=N/c2ccc(NNc3ccc(Nc4ccccc4)c4c(S(=O)(=O)O)cccc34)c3ccccc23)c1 |
| InChI | InChI=1S/C32H25N5O6S2/c38-44(39,40)23-11-6-10-22(20-23)34-35-27-16-17-28(25-13-5-4-12-24(25)27)36-37-29-18-19-30(33-21-8-2-1-3-9-21)32-26(29)14-7-15-31(32)45(41,42)43/h1-20,33,36-37H,(H,38,39,40)(H,41,42,43)/b35-34+ |
| InChIKey | DZSOYVQTTFLKMQ-XAHDOWKMSA-N |
| XLogP | 8.08 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.72 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|