C24H21N3O9S3 — CID 170552216
8-anilino-7-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 170552216) has the molecular formula C24H21N3O9S3 and a molecular weight of 591.65 g/mol. Its IUPAC name is 8-anilino-7-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 8-anilino-7-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 170552216 |
| Molecular Formula | C24H21N3O9S3 |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | 8-anilino-7-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)OCCS(=O)(=O)c1ccc(/N=N/c2ccc3cccc(S(=O)(=O)O)c3c2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O9S3/c28-37(29,16-15-36-39(33,34)35)20-12-10-19(11-13-20)26-27-21-14-9-17-5-4-8-22(38(30,31)32)23(17)24(21)25-18-6-2-1-3-7-18/h1-14,25H,15-16H2,(H,30,31,32)(H,33,34,35)/b27-26+ |
| InChIKey | ICLCJSGPURLRLI-CYYJNZCTSA-N |
| XLogP | 4.84 |
| TPSA | 188.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|