C27H23FN8O10S3 — CID 137006072
4-amino-3-[[4-[[4-fluoro-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]-5-hydroxynaphthalene-2-sulfonic acid (PubChem CID 137006072) has the molecular formula C27H23FN8O10S3 and a molecular weight of 734.73 g/mol. Its IUPAC name is 4-amino-3-[[4-[[4-fluoro-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]-5-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 4-amino-3-[[4-[[4-fluoro-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]-5-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137006072 |
| Molecular Formula | C27H23FN8O10S3 |
| Molecular Weight | 734.73 g/mol |
| Exact Mass | 734.07 |
| IUPAC Name | 4-amino-3-[[4-[[4-fluoro-6-[4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]-5-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(Nc3nc(F)nc(Nc4ccc(S(=O)(=O)CCOS(=O)(=O)O)cc4)n3)cc2)c(S(=O)(=O)O)cc2cccc(O)c12 |
| InChI | InChI=1S/C27H23FN8O10S3/c28-25-32-26(34-27(33-25)31-17-8-10-19(11-9-17)47(38,39)13-12-46-49(43,44)45)30-16-4-6-18(7-5-16)35-36-24-21(48(40,41)42)14-15-2-1-3-20(37)22(15)23(24)29/h1-11,14,37H,12-13,29H2,(H,40,41,42)(H,43,44,45)(H2,30,31,32,33,34)/b36-35+ |
| InChIKey | WRNFIJVWGBSXOC-ULDVOPSXSA-N |
| XLogP | 4.19 |
| TPSA | 285.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|