C25H19FN8O4S — CID 137006073
4-amino-3-[[4-[(4-anilino-6-fluoro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5-hydroxynaphthalene-2-sulfonic acid (PubChem CID 137006073) has the molecular formula C25H19FN8O4S and a molecular weight of 546.54 g/mol. Its IUPAC name is 4-amino-3-[[4-[(4-anilino-6-fluoro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 4-amino-3-[[4-[(4-anilino-6-fluoro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137006073 |
| Molecular Formula | C25H19FN8O4S |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | 4-amino-3-[[4-[(4-anilino-6-fluoro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(Nc3nc(F)nc(Nc4ccccc4)n3)cc2)c(S(=O)(=O)O)cc2cccc(O)c12 |
| InChI | InChI=1S/C25H19FN8O4S/c26-23-30-24(28-15-6-2-1-3-7-15)32-25(31-23)29-16-9-11-17(12-10-16)33-34-22-19(39(36,37)38)13-14-5-4-8-18(35)20(14)21(22)27/h1-13,35H,27H2,(H,36,37,38)(H2,28,29,30,31,32)/b34-33+ |
| InChIKey | AVPIDHXVTGMYOV-JEIPZWNWSA-N |
| XLogP | 5.60 |
| TPSA | 188.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|