C34H27N9O11S3 — CID 135848711
4-amino-3-[[4-[4-[(2-amino-4-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid (PubChem CID 135848711) has the molecular formula C34H27N9O11S3 and a molecular weight of 833.84 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[(2-amino-4-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[[4-[4-[(2-amino-4-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135848711 |
| Molecular Formula | C34H27N9O11S3 |
| Molecular Weight | 833.84 g/mol |
| Exact Mass | 833.10 |
| IUPAC Name | 4-amino-3-[[4-[4-[(2-amino-4-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| SMILES | Nc1cc(O)ccc1/N=N/c1ccc(Nc2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)c(/N=N/c5ccccc5)c(O)c4c3N)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C34H27N9O11S3/c35-24-17-23(44)11-13-25(24)41-38-21-8-6-19(7-9-21)37-26-12-10-22(16-27(26)55(46,47)48)40-42-32-28(56(49,50)51)14-18-15-29(57(52,53)54)33(34(45)30(18)31(32)36)43-39-20-4-2-1-3-5-20/h1-17,37,44-45H,35-36H2,(H,46,47,48)(H,49,50,51)(H,52,53,54)/b41-38+,42-40+,43-39+ |
| InChIKey | YNERWMOTPGGJNE-MGDYUOCISA-N |
| XLogP | 8.15 |
| TPSA | 341.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.84 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|