C35H29N9O11S3 — CID 142625508
4-amino-3-[[4-[4-[(2-amino-4-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-hydroxy-6-[(3-methylphenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 142625508) has the molecular formula C35H29N9O11S3 and a molecular weight of 847.87 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[(2-amino-4-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-hydroxy-6-[(3-methylphenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[[4-[4-[(2-amino-4-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-hydroxy-6-[(3-methylphenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 142625508 |
| Molecular Formula | C35H29N9O11S3 |
| Molecular Weight | 847.87 g/mol |
| Exact Mass | 847.11 |
| IUPAC Name | 4-amino-3-[[4-[4-[(2-amino-4-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-5-hydroxy-6-[(3-methylphenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Cc1cccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(Nc5ccc(/N=N/c6ccc(O)cc6N)cc5)c(S(=O)(=O)O)c4)c(N)c3c2O)c1 |
| InChI | InChI=1S/C35H29N9O11S3/c1-18-3-2-4-22(13-18)40-44-34-30(58(53,54)55)15-19-14-29(57(50,51)52)33(32(37)31(19)35(34)46)43-41-23-9-11-27(28(16-23)56(47,48)49)38-20-5-7-21(8-6-20)39-42-26-12-10-24(45)17-25(26)36/h2-17,38,45-46H,36-37H2,1H3,(H,47,48,49)(H,50,51,52)(H,53,54,55)/b42-39+,43-41+,44-40+ |
| InChIKey | OYSOSNZKAQXFLM-AUVAVNHBSA-N |
| XLogP | 8.45 |
| TPSA | 341.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.87 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|