C24H21N5O7S2 — CID 137117806
4-amino-5-hydroxy-6-[(3-methylphenyl)diazenyl]-3-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide (PubChem CID 137117806) has the molecular formula C24H21N5O7S2 and a molecular weight of 555.59 g/mol. Its IUPAC name is 4-amino-5-hydroxy-6-[(3-methylphenyl)diazenyl]-3-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide.
| Compound Name | 4-amino-5-hydroxy-6-[(3-methylphenyl)diazenyl]-3-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 137117806 |
| Molecular Formula | C24H21N5O7S2 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | 4-amino-5-hydroxy-6-[(3-methylphenyl)diazenyl]-3-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide |
| SMILES | Cc1ccc(/N=N/c2c(S(=O)(=O)O)cc3ccc(/N=N/c4cccc(C)c4)c(O)c3c2N)cc1.O=S(=O)=O |
| InChI | InChI=1S/C24H21N5O4S.O3S/c1-14-6-9-17(10-7-14)26-29-23-20(34(31,32)33)13-16-8-11-19(24(30)21(16)22(23)25)28-27-18-5-3-4-15(2)12-18;1-4(2)3/h3-13,30H,25H2,1-2H3,(H,31,32,33);/b28-27+,29-26+; |
| InChIKey | ZZOXIJSYGXMZLK-ITGFPFMLSA-N |
| XLogP | 5.82 |
| TPSA | 201.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|