C25H23N5O13S4 — CID 136503741
4-amino-5-hydroxy-6-[(4-methylphenyl)diazenyl]-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide (PubChem CID 136503741) has the molecular formula C25H23N5O13S4 and a molecular weight of 729.75 g/mol. Its IUPAC name is 4-amino-5-hydroxy-6-[(4-methylphenyl)diazenyl]-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide.
| Compound Name | 4-amino-5-hydroxy-6-[(4-methylphenyl)diazenyl]-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 136503741 |
| Molecular Formula | C25H23N5O13S4 |
| Molecular Weight | 729.75 g/mol |
| Exact Mass | 729.02 |
| IUPAC Name | 4-amino-5-hydroxy-6-[(4-methylphenyl)diazenyl]-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide |
| SMILES | Cc1ccc(/N=N/c2ccc3cc(S(=O)(=O)O)c(/N=N/c4ccc(S(=O)(=O)CCOS(=O)(=O)O)cc4)c(N)c3c2O)cc1.O=S(=O)=O |
| InChI | InChI=1S/C25H23N5O10S3.O3S/c1-15-2-5-17(6-3-15)27-29-20-11-4-16-14-21(42(34,35)36)24(23(26)22(16)25(20)31)30-28-18-7-9-19(10-8-18)41(32,33)13-12-40-43(37,38)39;1-4(2)3/h2-11,14,31H,12-13,26H2,1H3,(H,34,35,36)(H,37,38,39);/b29-27+,30-28+; |
| InChIKey | LWBDDJPTZYIXPR-MANJTEISSA-N |
| XLogP | 4.10 |
| TPSA | 299.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.75 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|