C44H61N5O8S3 — CID 165053786
5-amino-4-hydroxy-3,6-bis[[4-(4,4,6,6-tetramethylheptylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 165053786) has the molecular formula C44H61N5O8S3 and a molecular weight of 884.20 g/mol. Its IUPAC name is 5-amino-4-hydroxy-3,6-bis[[4-(4,4,6,6-tetramethylheptylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-amino-4-hydroxy-3,6-bis[[4-(4,4,6,6-tetramethylheptylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 165053786 |
| Molecular Formula | C44H61N5O8S3 |
| Molecular Weight | 884.20 g/mol |
| Exact Mass | 883.37 |
| IUPAC Name | 5-amino-4-hydroxy-3,6-bis[[4-(4,4,6,6-tetramethylheptylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CC(C)(C)CC(C)(C)CCCS(=O)(=O)c1ccc(/N=N/c2ccc3cc(S(=O)(=O)O)c(/N=N/c4ccc(S(=O)(=O)CCCC(C)(C)CC(C)(C)C)cc4)c(O)c3c2N)cc1 |
| InChI | InChI=1S/C44H61N5O8S3/c1-41(2,3)28-43(7,8)23-11-25-58(51,52)33-18-14-31(15-19-33)46-48-35-22-13-30-27-36(60(55,56)57)39(40(50)37(30)38(35)45)49-47-32-16-20-34(21-17-32)59(53,54)26-12-24-44(9,10)29-42(4,5)6/h13-22,27,50H,11-12,23-26,28-29,45H2,1-10H3,(H,55,56,57)/b48-46+,49-47+ |
| InChIKey | OZNHPMJQKLCRPB-ROHDNENLSA-N |
| XLogP | 12.24 |
| TPSA | 218.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.20 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|