C43H61N7O8S3 — CID 165013681
5-amino-3,6-bis[[4-[2-(dibutylamino)ethylsulfonyl]phenyl]diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid (PubChem CID 165013681) has the molecular formula C43H61N7O8S3 and a molecular weight of 900.20 g/mol. Its IUPAC name is 5-amino-3,6-bis[[4-[2-(dibutylamino)ethylsulfonyl]phenyl]diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid.
| Compound Name | 5-amino-3,6-bis[[4-[2-(dibutylamino)ethylsulfonyl]phenyl]diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 165013681 |
| Molecular Formula | C43H61N7O8S3 |
| Molecular Weight | 900.20 g/mol |
| Exact Mass | 899.37 |
| IUPAC Name | 5-amino-3,6-bis[[4-[2-(dibutylamino)ethylsulfonyl]phenyl]diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid |
| SMILES | CCCCN(CCCC)CCS(=O)(=O)c1ccc(/N=N/c2c(C)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(S(=O)(=O)CCN(CCCC)CCCC)cc4)c(O)c3c2N)cc1 |
| InChI | InChI=1S/C43H61N7O8S3/c1-6-10-22-49(23-11-7-2)26-28-59(52,53)36-18-14-34(15-19-36)45-47-41-32(5)30-33-31-38(61(56,57)58)42(43(51)39(33)40(41)44)48-46-35-16-20-37(21-17-35)60(54,55)29-27-50(24-12-8-3)25-13-9-4/h14-21,30-31,51H,6-13,22-29,44H2,1-5H3,(H,56,57,58)/b47-45+,48-46+ |
| InChIKey | KBSSVFPVTCOWIO-MLGMXDONSA-N |
| XLogP | 9.87 |
| TPSA | 224.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.20 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|