C24H19F2N5O16S5 — CID 143998711
5-amino-3-[(4,5-difluoro-2-sulfophenyl)diazenyl]-4-hydroxy-6-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 143998711) has the molecular formula C24H19F2N5O16S5 and a molecular weight of 831.77 g/mol. Its IUPAC name is 5-amino-3-[(4,5-difluoro-2-sulfophenyl)diazenyl]-4-hydroxy-6-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-3-[(4,5-difluoro-2-sulfophenyl)diazenyl]-4-hydroxy-6-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 143998711 |
| Molecular Formula | C24H19F2N5O16S5 |
| Molecular Weight | 831.77 g/mol |
| Exact Mass | 830.94 |
| IUPAC Name | 5-amino-3-[(4,5-difluoro-2-sulfophenyl)diazenyl]-4-hydroxy-6-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3cc(F)c(F)cc3S(=O)(=O)O)c(O)c12 |
| InChI | InChI=1S/C24H19F2N5O16S5/c25-14-9-16(17(10-15(14)26)49(35,36)37)29-31-23-19(51(41,42)43)8-11-7-18(50(38,39)40)22(21(27)20(11)24(23)32)30-28-12-1-3-13(4-2-12)48(33,34)6-5-47-52(44,45)46/h1-4,7-10,32H,5-6,27H2,(H,35,36,37)(H,38,39,40)(H,41,42,43)(H,44,45,46)/b30-28+,31-29+ |
| InChIKey | PQJUEJHAVSFKQH-FUEWEDNTSA-N |
| XLogP | 3.57 |
| TPSA | 356.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.77 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|