C29H21F2N7O13S4 — CID 136653779
5-amino-3-[[5-fluoro-4-[(4-methylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-6-[(5-fluoro-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136653779) has the molecular formula C29H21F2N7O13S4 and a molecular weight of 841.79 g/mol. Its IUPAC name is 5-amino-3-[[5-fluoro-4-[(4-methylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-6-[(5-fluoro-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-3-[[5-fluoro-4-[(4-methylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-6-[(5-fluoro-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136653779 |
| Molecular Formula | C29H21F2N7O13S4 |
| Molecular Weight | 841.79 g/mol |
| Exact Mass | 841.00 |
| IUPAC Name | 5-amino-3-[[5-fluoro-4-[(4-methylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-6-[(5-fluoro-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Cc1ccc(/N=N/c2cc(S(=O)(=O)O)c(/N=N/c3c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)c(/N=N/c5cc(F)ccc5S(=O)(=O)O)c(N)c4c3O)cc2F)cc1 |
| InChI | InChI=1S/C29H21F2N7O13S4/c1-13-2-5-16(6-3-13)33-34-18-12-22(53(43,44)45)20(11-17(18)31)36-38-28-24(55(49,50)51)9-14-8-23(54(46,47)48)27(26(32)25(14)29(28)39)37-35-19-10-15(30)4-7-21(19)52(40,41)42/h2-12,39H,32H2,1H3,(H,40,41,42)(H,43,44,45)(H,46,47,48)(H,49,50,51)/b34-33+,37-35+,38-36+ |
| InChIKey | YGPOHLMWWFCACK-PUHBABMSSA-N |
| XLogP | 6.95 |
| TPSA | 337.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.79 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|