C26H23FN8O9S3 — CID 91000261
2,4-diamino-3-[[5-fluoro-4-[(4-methylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-5-[(4-methyl-2-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 91000261) has the molecular formula C26H23FN8O9S3 and a molecular weight of 706.72 g/mol. Its IUPAC name is 2,4-diamino-3-[[5-fluoro-4-[(4-methylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-5-[(4-methyl-2-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2,4-diamino-3-[[5-fluoro-4-[(4-methylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-5-[(4-methyl-2-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 91000261 |
| Molecular Formula | C26H23FN8O9S3 |
| Molecular Weight | 706.72 g/mol |
| Exact Mass | 706.07 |
| IUPAC Name | 2,4-diamino-3-[[5-fluoro-4-[(4-methylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-5-[(4-methyl-2-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1ccc(/N=N/c2cc(S(=O)(=O)O)c(/N=N/c3c(N)c(/N=N/c4ccc(C)cc4S(=O)(=O)O)cc(S(=O)(=O)O)c3N)cc2F)cc1 |
| InChI | InChI=1S/C26H23FN8O9S3/c1-13-3-6-15(7-4-13)30-32-18-11-22(46(39,40)41)19(10-16(18)27)33-35-26-24(28)20(12-23(25(26)29)47(42,43)44)34-31-17-8-5-14(2)9-21(17)45(36,37)38/h3-12H,28-29H2,1-2H3,(H,36,37,38)(H,39,40,41)(H,42,43,44)/b32-30+,34-31+,35-33+ |
| InChIKey | SJFNPOWIQBBSKD-JYZMYSRCSA-N |
| XLogP | 6.59 |
| TPSA | 289.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|