C23H17F2N5O13S4 — CID 136648813
4-[[2-amino-5-hydroxy-6-[(4-methyl-2-sulfophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-2,6-difluorobenzene-1,3-disulfonic acid (PubChem CID 136648813) has the molecular formula C23H17F2N5O13S4 and a molecular weight of 737.67 g/mol. Its IUPAC name is 4-[[2-amino-5-hydroxy-6-[(4-methyl-2-sulfophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-2,6-difluorobenzene-1,3-disulfonic acid.
| Compound Name | 4-[[2-amino-5-hydroxy-6-[(4-methyl-2-sulfophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-2,6-difluorobenzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 136648813 |
| Molecular Formula | C23H17F2N5O13S4 |
| Molecular Weight | 737.67 g/mol |
| Exact Mass | 736.97 |
| IUPAC Name | 4-[[2-amino-5-hydroxy-6-[(4-methyl-2-sulfophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]-2,6-difluorobenzene-1,3-disulfonic acid |
| SMILES | Cc1ccc(/N=N/c2c(S(=O)(=O)O)cc3c(/N=N/c4cc(F)c(S(=O)(=O)O)c(F)c4S(=O)(=O)O)c(N)ccc3c2O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C23H17F2N5O13S4/c1-9-2-5-14(16(6-9)44(32,33)34)27-30-20-17(45(35,36)37)7-11-10(21(20)31)3-4-13(26)19(11)29-28-15-8-12(24)22(46(38,39)40)18(25)23(15)47(41,42)43/h2-8,31H,26H2,1H3,(H,32,33,34)(H,35,36,37)(H,38,39,40)(H,41,42,43)/b29-28+,30-27+ |
| InChIKey | OKUFQPBXCKZDDY-ZKIWJVNISA-N |
| XLogP | 4.53 |
| TPSA | 313.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|