C28H27N5O16S5 — CID 165364010
7-amino-8-[(4-ethenylsulfonyl-2-sulfophenyl)diazenyl]-4-hydroxy-3-[[2-methoxy-5-methyl-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 165364010) has the molecular formula C28H27N5O16S5 and a molecular weight of 849.88 g/mol. Its IUPAC name is 7-amino-8-[(4-ethenylsulfonyl-2-sulfophenyl)diazenyl]-4-hydroxy-3-[[2-methoxy-5-methyl-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-amino-8-[(4-ethenylsulfonyl-2-sulfophenyl)diazenyl]-4-hydroxy-3-[[2-methoxy-5-methyl-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 165364010 |
| Molecular Formula | C28H27N5O16S5 |
| Molecular Weight | 849.88 g/mol |
| Exact Mass | 849.01 |
| IUPAC Name | 7-amino-8-[(4-ethenylsulfonyl-2-sulfophenyl)diazenyl]-4-hydroxy-3-[[2-methoxy-5-methyl-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | C=CS(=O)(=O)c1ccc(/N=N/c2c(N)ccc3c(O)c(/N=N/c4cc(C)c(S(=O)(=O)CCOS(=O)(=O)O)cc4OC)c(S(=O)(=O)O)cc23)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H27N5O16S5/c1-4-50(35,36)16-5-8-20(24(12-16)52(39,40)41)30-32-26-18-13-25(53(42,43)44)27(28(34)17(18)6-7-19(26)29)33-31-21-11-15(2)23(14-22(21)48-3)51(37,38)10-9-49-54(45,46)47/h4-8,11-14,34H,1,9-10,29H2,2-3H3,(H,39,40,41)(H,42,43,44)(H,45,46,47)/b32-30+,33-31+ |
| InChIKey | WCMLEDZTDHOJFT-RRPBDJRISA-N |
| XLogP | 4.28 |
| TPSA | 345.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.88 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|