C28H29N5O10S3 — CID 136652758
4-hydroxy-3-[(2-methoxy-5-sulfophenyl)diazenyl]-7-(methylamino)-8-[(2-methyl-4-propylsulfonylphenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136652758) has the molecular formula C28H29N5O10S3 and a molecular weight of 691.77 g/mol. Its IUPAC name is 4-hydroxy-3-[(2-methoxy-5-sulfophenyl)diazenyl]-7-(methylamino)-8-[(2-methyl-4-propylsulfonylphenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 4-hydroxy-3-[(2-methoxy-5-sulfophenyl)diazenyl]-7-(methylamino)-8-[(2-methyl-4-propylsulfonylphenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136652758 |
| Molecular Formula | C28H29N5O10S3 |
| Molecular Weight | 691.77 g/mol |
| Exact Mass | 691.11 |
| IUPAC Name | 4-hydroxy-3-[(2-methoxy-5-sulfophenyl)diazenyl]-7-(methylamino)-8-[(2-methyl-4-propylsulfonylphenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CCCS(=O)(=O)c1ccc(/N=N/c2c(NC)ccc3c(O)c(/N=N/c4cc(S(=O)(=O)O)ccc4OC)c(S(=O)(=O)O)cc23)c(C)c1 |
| InChI | InChI=1S/C28H29N5O10S3/c1-5-12-44(35,36)17-6-9-21(16(2)13-17)30-32-26-20-15-25(46(40,41)42)27(28(34)19(20)8-10-22(26)29-3)33-31-23-14-18(45(37,38)39)7-11-24(23)43-4/h6-11,13-15,29,34H,5,12H2,1-4H3,(H,37,38,39)(H,40,41,42)/b32-30+,33-31+ |
| InChIKey | ISDONABVGWYSLW-RRPBDJRISA-N |
| XLogP | 6.41 |
| TPSA | 233.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.77 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|