C28H29N5O6S — CID 136985405
6-(ethylamino)-5-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-2-[(2-hydroxy-5-methoxyphenyl)diazenyl]naphthalen-1-ol (PubChem CID 136985405) has the molecular formula C28H29N5O6S and a molecular weight of 563.64 g/mol. Its IUPAC name is 6-(ethylamino)-5-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-2-[(2-hydroxy-5-methoxyphenyl)diazenyl]naphthalen-1-ol.
| Compound Name | 6-(ethylamino)-5-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-2-[(2-hydroxy-5-methoxyphenyl)diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 136985405 |
| Molecular Formula | C28H29N5O6S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 6-(ethylamino)-5-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-2-[(2-hydroxy-5-methoxyphenyl)diazenyl]naphthalen-1-ol |
| SMILES | CCNc1ccc2c(O)c(/N=N/c3cc(OC)ccc3O)ccc2c1/N=N/c1cc(S(=O)(=O)CC)ccc1OC |
| InChI | InChI=1S/C28H29N5O6S/c1-5-29-21-11-10-20-19(9-12-22(28(20)35)30-31-23-15-17(38-3)7-13-25(23)34)27(21)33-32-24-16-18(40(36,37)6-2)8-14-26(24)39-4/h7-16,29,34-35H,5-6H2,1-4H3/b31-30+,33-32+ |
| InChIKey | MAZKPSWYVJUTJP-CJQWSLHQSA-N |
| XLogP | 7.32 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|