C17H22N2O5S — CID 135894148
2-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 135894148) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 2-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135894148 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[(5-ethylsulfonyl-2-methoxyphenyl)diazenyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CCS(=O)(=O)c1ccc(OC)c(/N=N/C2=C(O)CC(C)(C)CC2=O)c1 |
| InChI | InChI=1S/C17H22N2O5S/c1-5-25(22,23)11-6-7-15(24-4)12(8-11)18-19-16-13(20)9-17(2,3)10-14(16)21/h6-8,20H,5,9-10H2,1-4H3/b19-18+ |
| InChIKey | OICOFGKFASNVAU-VHEBQXMUSA-N |
| XLogP | 3.73 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|