C11H13N7O4S — CID 89270814
4-methoxy-3-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzenesulfonic acid (PubChem CID 89270814) has the molecular formula C11H13N7O4S and a molecular weight of 339.34 g/mol. Its IUPAC name is 4-methoxy-3-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-methoxy-3-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89270814 |
| Molecular Formula | C11H13N7O4S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 4-methoxy-3-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]benzenesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)O)cc1/N=N/c1c(N)nc(N)nc1N |
| InChI | InChI=1S/C11H13N7O4S/c1-22-7-3-2-5(23(19,20)21)4-6(7)17-18-8-9(12)15-11(14)16-10(8)13/h2-4H,1H3,(H,19,20,21)(H6,12,13,14,15,16)/b18-17+ |
| InChIKey | KPKNFPVFEVOMTJ-ISLYRVAYSA-N |
| XLogP | 0.89 |
| TPSA | 192.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|