C25H23N5O12S3 — CID 137493023
4-[[4-[(4-amino-3-methoxy-7-sulfonaphthalen-1-yl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]benzene-1,3-disulfonic acid (PubChem CID 137493023) has the molecular formula C25H23N5O12S3 and a molecular weight of 681.68 g/mol. Its IUPAC name is 4-[[4-[(4-amino-3-methoxy-7-sulfonaphthalen-1-yl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[[4-[(4-amino-3-methoxy-7-sulfonaphthalen-1-yl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 137493023 |
| Molecular Formula | C25H23N5O12S3 |
| Molecular Weight | 681.68 g/mol |
| Exact Mass | 681.05 |
| IUPAC Name | 4-[[4-[(4-amino-3-methoxy-7-sulfonaphthalen-1-yl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]benzene-1,3-disulfonic acid |
| SMILES | COc1cc(/N=N/c2cc(OC)c(N)c3ccc(S(=O)(=O)O)cc23)c(OC)cc1/N=N/c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C25H23N5O12S3/c1-40-21-12-20(30-28-18-10-23(42-3)25(26)15-6-4-13(8-16(15)18)43(31,32)33)22(41-2)11-19(21)29-27-17-7-5-14(44(34,35)36)9-24(17)45(37,38)39/h4-12H,26H2,1-3H3,(H,31,32,33)(H,34,35,36)(H,37,38,39)/b29-27+,30-28+ |
| InChIKey | PIYYDZPNMIZYEC-QAVVBOBSSA-N |
| XLogP | 5.02 |
| TPSA | 266.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|