C19H18N2O7S2 — CID 89345722
4-[(5-methoxy-2,4-dimethylphenyl)diazenyl]naphthalene-2,6-disulfonic acid (PubChem CID 89345722) has the molecular formula C19H18N2O7S2 and a molecular weight of 450.49 g/mol. Its IUPAC name is 4-[(5-methoxy-2,4-dimethylphenyl)diazenyl]naphthalene-2,6-disulfonic acid.
| Compound Name | 4-[(5-methoxy-2,4-dimethylphenyl)diazenyl]naphthalene-2,6-disulfonic acid |
|---|---|
| PubChem CID | 89345722 |
| Molecular Formula | C19H18N2O7S2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 4-[(5-methoxy-2,4-dimethylphenyl)diazenyl]naphthalene-2,6-disulfonic acid |
| SMILES | COc1cc(/N=N/c2cc(S(=O)(=O)O)cc3ccc(S(=O)(=O)O)cc23)c(C)cc1C |
| InChI | InChI=1S/C19H18N2O7S2/c1-11-6-12(2)19(28-3)10-17(11)20-21-18-9-15(30(25,26)27)7-13-4-5-14(8-16(13)18)29(22,23)24/h4-10H,1-3H3,(H,22,23,24)(H,25,26,27)/b21-20+ |
| InChIKey | LMLXYCNDBIBIBJ-QZQOTICOSA-N |
| XLogP | 4.37 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|