C25H23N5O8S2 — CID 137492596
8-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-5-[(2-methyl-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 137492596) has the molecular formula C25H23N5O8S2 and a molecular weight of 585.62 g/mol. Its IUPAC name is 8-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-5-[(2-methyl-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 8-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-5-[(2-methyl-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137492596 |
| Molecular Formula | C25H23N5O8S2 |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | 8-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-5-[(2-methyl-4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3C)c3ccc(S(=O)(=O)O)cc23)c(OC)cc1N |
| InChI | InChI=1S/C25H23N5O8S2/c1-14-10-15(39(31,32)33)5-7-20(14)27-28-21-8-9-22(18-11-16(40(34,35)36)4-6-17(18)21)29-30-23-13-24(37-2)19(26)12-25(23)38-3/h4-13H,26H2,1-3H3,(H,31,32,33)(H,34,35,36)/b28-27+,30-29+ |
| InChIKey | RJXUKJKVBIVNSW-XOXGWFOHSA-N |
| XLogP | 6.07 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|