C14H13N3Na2O7S2 — CID 102503830
disodium;2-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]benzene-1,4-disulfonate (PubChem CID 102503830) has the molecular formula C14H13N3Na2O7S2 and a molecular weight of 445.39 g/mol. Its IUPAC name is disodium;2-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]benzene-1,4-disulfonate.
| Compound Name | disodium;2-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]benzene-1,4-disulfonate |
|---|---|
| PubChem CID | 102503830 |
| Molecular Formula | C14H13N3Na2O7S2 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | disodium;2-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]benzene-1,4-disulfonate |
| SMILES | COc1cc(/N=N/c2cc(S(=O)(=O)[O-])ccc2S(=O)(=O)[O-])c(C)cc1N.[Na+].[Na+] |
| InChI | InChI=1S/C14H15N3O7S2.2Na/c1-8-5-10(15)13(24-2)7-11(8)16-17-12-6-9(25(18,19)20)3-4-14(12)26(21,22)23;;/h3-7H,15H2,1-2H3,(H,18,19,20)(H,21,22,23);;/q;2*+1/p-2/b17-16+;; |
| InChIKey | JIOLADABABPJFF-WXIBIURSSA-L |
| XLogP | -4.18 |
| TPSA | 174.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|