C25H21N3Na2O10S3 — CID 102269569
disodium;1-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-5-(4-methylphenyl)sulfonyloxynaphthalene-2,7-disulfonate (PubChem CID 102269569) has the molecular formula C25H21N3Na2O10S3 and a molecular weight of 665.63 g/mol. Its IUPAC name is disodium;1-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-5-(4-methylphenyl)sulfonyloxynaphthalene-2,7-disulfonate.
| Compound Name | disodium;1-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-5-(4-methylphenyl)sulfonyloxynaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 102269569 |
| Molecular Formula | C25H21N3Na2O10S3 |
| Molecular Weight | 665.63 g/mol |
| Exact Mass | 665.02 |
| IUPAC Name | disodium;1-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-5-(4-methylphenyl)sulfonyloxynaphthalene-2,7-disulfonate |
| SMILES | COc1cc(/N=N/c2c(S(=O)(=O)[O-])ccc3c(OS(=O)(=O)c4ccc(C)cc4)cc(S(=O)(=O)[O-])cc23)c(C)cc1N.[Na+].[Na+] |
| InChI | InChI=1S/C25H23N3O10S3.2Na/c1-14-4-6-16(7-5-14)41(35,36)38-22-12-17(39(29,30)31)11-19-18(22)8-9-24(40(32,33)34)25(19)28-27-21-13-23(37-3)20(26)10-15(21)2;;/h4-13H,26H2,1-3H3,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2/b28-27+;; |
| InChIKey | QGYSEVGPOKPDRP-JZYARHMISA-L |
| XLogP | -1.95 |
| TPSA | 217.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.63 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|