C28H19N5O16S4-4 — CID 3770913
4-amino-6-[[4-[(1,8-dihydroxy-3,6-disulfonatonaphthalen-2-yl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonate (PubChem CID 3770913) has the molecular formula C28H19N5O16S4-4 and a molecular weight of 809.75 g/mol. Its IUPAC name is 4-amino-6-[[4-[(1,8-dihydroxy-3,6-disulfonatonaphthalen-2-yl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonate.
| Compound Name | 4-amino-6-[[4-[(1,8-dihydroxy-3,6-disulfonatonaphthalen-2-yl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 3770913 |
| Molecular Formula | C28H19N5O16S4-4 |
| Molecular Weight | 809.75 g/mol |
| Exact Mass | 808.97 |
| IUPAC Name | 4-amino-6-[[4-[(1,8-dihydroxy-3,6-disulfonatonaphthalen-2-yl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonate |
| SMILES | COc1cc(/N=N/c2c(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])cc(O)c3c2O)c(C)cc1/N=N/c1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c(N)c2c1O |
| InChI | InChI=1S/C28H23N5O16S4/c1-11-5-17(32-30-15-4-3-14-20(51(40,41)42)10-21(52(43,44)45)25(29)24(14)27(15)35)19(49-2)9-16(11)31-33-26-22(53(46,47)48)7-12-6-13(50(37,38)39)8-18(34)23(12)28(26)36/h3-10,34-36H,29H2,1-2H3,(H,37,38,39)(H,40,41,42)(H,43,44,45)(H,46,47,48)/p-4/b32-30+,33-31+ |
| InChIKey | BCYPBMFLUDSDMI-RRPBDJRISA-J |
| XLogP | 3.46 |
| TPSA | 374.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.75 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|