C25H19Li2N7O11S2 — CID 140666096
dilithium;6-[[5-acetamido-2-methoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-4-amino-5-hydroxynaphthalene-1,3-disulfonate (PubChem CID 140666096) has the molecular formula C25H19Li2N7O11S2 and a molecular weight of 671.48 g/mol. Its IUPAC name is dilithium;6-[[5-acetamido-2-methoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-4-amino-5-hydroxynaphthalene-1,3-disulfonate.
| Compound Name | dilithium;6-[[5-acetamido-2-methoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-4-amino-5-hydroxynaphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 140666096 |
| Molecular Formula | C25H19Li2N7O11S2 |
| Molecular Weight | 671.48 g/mol |
| Exact Mass | 671.09 |
| IUPAC Name | dilithium;6-[[5-acetamido-2-methoxy-4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]-4-amino-5-hydroxynaphthalene-1,3-disulfonate |
| SMILES | COc1cc(/N=N/c2ccc([N+](=O)[O-])cc2)c(NC(C)=O)cc1/N=N/c1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c(N)c2c1O.[Li+].[Li+] |
| InChI | InChI=1S/C25H21N7O11S2.2Li/c1-12(33)27-17-9-19(20(43-2)10-18(17)30-28-13-3-5-14(6-4-13)32(35)36)31-29-16-8-7-15-21(44(37,38)39)11-22(45(40,41)42)24(26)23(15)25(16)34;;/h3-11,34H,26H2,1-2H3,(H,27,33)(H,37,38,39)(H,40,41,42);;/q;2*+1/p-2/b30-28+,31-29+;; |
| InChIKey | LBMBKYYJRPGMAN-DBHLKOEUSA-L |
| XLogP | -1.35 |
| TPSA | 291.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.48 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|