C30H29N7Na2O10S2 — CID 176887522
disodium;4-amino-6-[[4-[4-[[2-[2-(2-azidoethoxy)ethoxy]acetyl]amino]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonate (PubChem CID 176887522) has the molecular formula C30H29N7Na2O10S2 and a molecular weight of 757.71 g/mol. Its IUPAC name is disodium;4-amino-6-[[4-[4-[[2-[2-(2-azidoethoxy)ethoxy]acetyl]amino]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonate.
| Compound Name | disodium;4-amino-6-[[4-[4-[[2-[2-(2-azidoethoxy)ethoxy]acetyl]amino]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 176887522 |
| Molecular Formula | C30H29N7Na2O10S2 |
| Molecular Weight | 757.71 g/mol |
| Exact Mass | 757.12 |
| IUPAC Name | disodium;4-amino-6-[[4-[4-[[2-[2-(2-azidoethoxy)ethoxy]acetyl]amino]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonate |
| SMILES | Cc1cc(-c2ccc(NC(=O)COCCOCCN=[N+]=[N-])c(C)c2)ccc1/N=N/c1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c(N)c2c1O.[Na+].[Na+] |
| InChI | InChI=1S/C30H31N7O10S2.2Na/c1-17-13-19(3-6-22(17)34-27(38)16-47-12-11-46-10-9-33-37-32)20-4-7-23(18(2)14-20)35-36-24-8-5-21-25(48(40,41)42)15-26(49(43,44)45)29(31)28(21)30(24)39;;/h3-8,13-15,39H,9-12,16,31H2,1-2H3,(H,34,38)(H,40,41,42)(H,43,44,45);;/q;2*+1/p-2/b36-35+;; |
| InChIKey | AIYBVQDNIUQXIT-APVPWGIASA-L |
| XLogP | -1.07 |
| TPSA | 281.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.71 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|