C12H16ClNO4S — CID 107938552
3-methyl-4-[(2-propoxyacetyl)amino]benzenesulfonyl chloride (PubChem CID 107938552) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is 3-methyl-4-[(2-propoxyacetyl)amino]benzenesulfonyl chloride.
| Compound Name | 3-methyl-4-[(2-propoxyacetyl)amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 107938552 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-methyl-4-[(2-propoxyacetyl)amino]benzenesulfonyl chloride |
| SMILES | CCCOCC(=O)Nc1ccc(S(=O)(=O)Cl)cc1C |
| InChI | InChI=1S/C12H16ClNO4S/c1-3-6-18-8-12(15)14-11-5-4-10(7-9(11)2)19(13,16)17/h4-5,7H,3,6,8H2,1-2H3,(H,14,15) |
| InChIKey | JEWFEZZKBOCVNX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|