C13H19NO3 — CID 113256572
N-(5-methoxy-2-methylphenyl)-2-propoxyacetamide (PubChem CID 113256572) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(5-methoxy-2-methylphenyl)-2-propoxyacetamide.
| Compound Name | N-(5-methoxy-2-methylphenyl)-2-propoxyacetamide |
|---|---|
| PubChem CID | 113256572 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-(5-methoxy-2-methylphenyl)-2-propoxyacetamide |
| SMILES | CCCOCC(=O)Nc1cc(OC)ccc1C |
| InChI | InChI=1S/C13H19NO3/c1-4-7-17-9-13(15)14-12-8-11(16-3)6-5-10(12)2/h5-6,8H,4,7,9H2,1-3H3,(H,14,15) |
| InChIKey | RVUNYRBHRPNSPN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|