C13H16ClNO3S — CID 103162291
4-[(2-cyclobutylacetyl)amino]-3-methylbenzenesulfonyl chloride (PubChem CID 103162291) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is 4-[(2-cyclobutylacetyl)amino]-3-methylbenzenesulfonyl chloride.
| Compound Name | 4-[(2-cyclobutylacetyl)amino]-3-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 103162291 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 4-[(2-cyclobutylacetyl)amino]-3-methylbenzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)ccc1NC(=O)CC1CCC1 |
| InChI | InChI=1S/C13H16ClNO3S/c1-9-7-11(19(14,17)18)5-6-12(9)15-13(16)8-10-3-2-4-10/h5-7,10H,2-4,8H2,1H3,(H,15,16) |
| InChIKey | CAINFOJTNRURQV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |