C12H18N2O2 — CID 103747540
N-(2,6-dimethyl-3-pyridinyl)-2-propoxyacetamide (PubChem CID 103747540) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-(2,6-dimethyl-3-pyridinyl)-2-propoxyacetamide.
| Compound Name | N-(2,6-dimethyl-3-pyridinyl)-2-propoxyacetamide |
|---|---|
| PubChem CID | 103747540 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-(2,6-dimethyl-3-pyridinyl)-2-propoxyacetamide |
| SMILES | CCCOCC(=O)Nc1ccc(C)nc1C |
| InChI | InChI=1S/C12H18N2O2/c1-4-7-16-8-12(15)14-11-6-5-9(2)13-10(11)3/h5-6H,4,7-8H2,1-3H3,(H,14,15) |
| InChIKey | JFTRYJFSEJRQGQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|