C25H21IN4O8S2 — CID 145397743
4-amino-6-[[4-[4-(carboniodidoylamino)-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid (PubChem CID 145397743) has the molecular formula C25H21IN4O8S2 and a molecular weight of 696.50 g/mol. Its IUPAC name is 4-amino-6-[[4-[4-(carboniodidoylamino)-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid.
| Compound Name | 4-amino-6-[[4-[4-(carboniodidoylamino)-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 145397743 |
| Molecular Formula | C25H21IN4O8S2 |
| Molecular Weight | 696.50 g/mol |
| Exact Mass | 695.98 |
| IUPAC Name | 4-amino-6-[[4-[4-(carboniodidoylamino)-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
| SMILES | Cc1cc(-c2ccc(NC(=O)I)c(C)c2)ccc1/N=N/c1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c2c1O |
| InChI | InChI=1S/C25H21IN4O8S2/c1-12-9-14(3-6-17(12)28-25(26)32)15-4-7-18(13(2)10-15)29-30-19-8-5-16-20(39(33,34)35)11-21(40(36,37)38)23(27)22(16)24(19)31/h3-11,31H,27H2,1-2H3,(H,28,32)(H,33,34,35)(H,36,37,38)/b30-29+ |
| InChIKey | UEVINKCFFSFUIY-QVIHXGFCSA-N |
| XLogP | 6.29 |
| TPSA | 208.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|