C34H28N2O14S4 — CID 10010648
4-amino-6-[4-[4-(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)-3-methylphenyl]-2-methylphenyl]-5-hydroxynaphthalene-1,3-disulfonic acid (PubChem CID 10010648) has the molecular formula C34H28N2O14S4 and a molecular weight of 816.87 g/mol. Its IUPAC name is 4-amino-6-[4-[4-(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)-3-methylphenyl]-2-methylphenyl]-5-hydroxynaphthalene-1,3-disulfonic acid.
| Compound Name | 4-amino-6-[4-[4-(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)-3-methylphenyl]-2-methylphenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 10010648 |
| Molecular Formula | C34H28N2O14S4 |
| Molecular Weight | 816.87 g/mol |
| Exact Mass | 816.04 |
| IUPAC Name | 4-amino-6-[4-[4-(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)-3-methylphenyl]-2-methylphenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
| SMILES | Cc1cc(-c2ccc(-c3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c4c3O)c(C)c2)ccc1-c1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c2c1O |
| InChI | InChI=1S/C34H28N2O14S4/c1-15-11-17(3-5-19(15)21-7-9-23-25(51(39,40)41)13-27(53(45,46)47)31(35)29(23)33(21)37)18-4-6-20(16(2)12-18)22-8-10-24-26(52(42,43)44)14-28(54(48,49)50)32(36)30(24)34(22)38/h3-14,37-38H,35-36H2,1-2H3,(H,39,40,41)(H,42,43,44)(H,45,46,47)(H,48,49,50) |
| InChIKey | WNNKTBKCTNKTMY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 309.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.87 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|