C20H18N2NaO14S4 — CID 159749157
CID 159749157 (PubChem CID 159749157) has the molecular formula C20H18N2NaO14S4 and a molecular weight of 661.62 g/mol.
| Compound Name | CID 159749157 |
|---|---|
| PubChem CID | 159749157 |
| Molecular Formula | C20H18N2NaO14S4 |
| Molecular Weight | 661.62 g/mol |
| Exact Mass | 660.95 |
| IUPAC Name | — |
| SMILES | Nc1c(S(=O)(=O)O)cc(S(=O)(=O)O)c2cccc(O)c12.Nc1c(S(=O)(=O)O)cc(S(=O)(=O)O)c2cccc(O)c12.[Na] |
| InChI | InChI=1S/2C10H9NO7S2.Na/c2*11-10-8(20(16,17)18)4-7(19(13,14)15)5-2-1-3-6(12)9(5)10;/h2*1-4,12H,11H2,(H,13,14,15)(H,16,17,18); |
| InChIKey | VCZVFZXNXDUBKX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 309.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.62 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|