C10H10NNaO4S — CID 173284943
sodium;3-amino-4-hydroxynaphthalene-1-sulfonic acid;hydride (PubChem CID 173284943) has the molecular formula C10H10NNaO4S and a molecular weight of 263.25 g/mol. Its IUPAC name is sodium;3-amino-4-hydroxynaphthalene-1-sulfonic acid;hydride.
| Compound Name | sodium;3-amino-4-hydroxynaphthalene-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173284943 |
| Molecular Formula | C10H10NNaO4S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | sodium;3-amino-4-hydroxynaphthalene-1-sulfonic acid;hydride |
| SMILES | Nc1cc(S(=O)(=O)O)c2ccccc2c1O.[H-].[Na+] |
| InChI | InChI=1S/C10H9NO4S.Na.H/c11-8-5-9(16(13,14)15)6-3-1-2-4-7(6)10(8)12;;/h1-5,12H,11H2,(H,13,14,15);;/q;+1;-1 |
| InChIKey | POIHIXJHPFYANE-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|