About 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol
4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol (PubChem CID 88730201) has the molecular formula C20H17NO5S
and a molecular weight of 383.43 g/mol. Its IUPAC name is 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol.
Molecular Properties
| Compound Name | 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol |
| PubChem CID | 88730201 |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol |
| SMILES | Nc1c(O)cc(S(=O)(=O)O)c2ccccc12.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9NO4S.C10H8O/c11-10-7-4-2-1-3-6(7)9(5-8(10)12)16(13,14)15;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-5,12H,11H2,(H,13,14,15);1-7,11H |
| InChIKey | WDOGAHHZDMNMCG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_OH_no_alk_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol?
The IUPAC name of 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol (CID 88730201) is 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol.
What is the SMILES notation for 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol?
The canonical SMILES for 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol is Nc1c(O)cc(S(=O)(=O)O)c2ccccc12.Oc1ccc2ccccc2c1.
What is the InChIKey of 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol?
The InChIKey is WDOGAHHZDMNMCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4S.C10H8O/c11-10-7-4-2-1-3-6(7)9(5-8(10)12)16(13,14)15;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-5,12H,11H2,(H,13,14,15);1-7,11H.
What are the key properties of 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol?
4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol has a molecular weight of 383.43 g/mol, XLogP of 3.92, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol is sourced from PubChem (CID 88730201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).